2-(5-Amino-1,2,4-thiadiazol-3-yl)-2-(methoxyimino)acetic acid
Catalog No: FT-0641399
CAS No: 72217-12-0
- Chemical Name: 2-(5-Amino-1,2,4-thiadiazol-3-yl)-2-(methoxyimino)acetic acid
- Molecular Formula: C5H6N4O3S
- Molecular Weight: 202.19 g/mol
- InChI Key: OSIJZKVBQPTIMT-KRXBUXKQSA-N
- InChI: InChI=1S/C5H6N4O3S/c1-12-8-2(4(10)11)3-7-5(6)13-9-3/h1H3,(H,10,11)(H2,6,7,9)/b8-2+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(5-Amino-1,2,4-Thiadiazol-3-yl)-2-(Methoxyimino)Acetic Acid |
|---|---|
| Flash_Point: | 214.1±24.0 °C |
| Melting_Point: | N/A |
| FW: | 202.191 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 72217-12-0 |
| Bolling_Point: | 430.4±28.0 °C at 760 mmHg |
| MF: | C5H6N4O3S |
| Molecular_Structure: | ['1 . Molar refractive index 4483 ', '2 . Molar volume 1101 ', '3 . Parachor (902K)3315 ', '4 . Surface tension 820 ', '5 . Polarizability 1777'] |
|---|---|
| LogP: | -0.02 |
| Flash_Point: | 214.1±24.0 °C |
| Refractive_Index: | 1.749 |
| FW: | 202.191 |
| Bolling_Point: | 430.4±28.0 °C at 760 mmHg |
| Density: | 1.8±0.1 g/cm3 |
| PSA: | 138.93000 |
| Exact_Mass: | 202.016068 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| MF: | C5H6N4O3S |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
| HS_Code: | 2934999090 |
| WGK_Germany: | 3 |
| Safety_Statements: | S26-S36 |
Related Products
5,5'-Diamino-3,3,3',3'-tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol
N-Methyl-2-(pyridin-2-yl)-N-[2-(pyridin-2-yl)ethyl]ethanamine Trihydrochloride
1-Piperidinebutanol, 4-(hydroxydiphenylmethyl)-alpha-(4-(1-methylethyl)phenyl)-